C24H37N5O8S2 — CID 146507147
2-[3-[[2-[[2-[[2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]acetyl]amino]acetyl]amino]acetyl]amino]propyldisulfanyl]propyl acetate (PubChem CID 146507147) has the molecular formula C24H37N5O8S2 and a molecular weight of 587.72 g/mol. Its IUPAC name is 2-[3-[[2-[[2-[[2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]acetyl]amino]acetyl]amino]acetyl]amino]propyldisulfanyl]propyl acetate.
| Compound Name | 2-[3-[[2-[[2-[[2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]acetyl]amino]acetyl]amino]acetyl]amino]propyldisulfanyl]propyl acetate |
|---|---|
| PubChem CID | 146507147 |
| Molecular Formula | C24H37N5O8S2 |
| Molecular Weight | 587.72 g/mol |
| Exact Mass | 587.21 |
| IUPAC Name | 2-[3-[[2-[[2-[[2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]acetyl]amino]acetyl]amino]acetyl]amino]propyldisulfanyl]propyl acetate |
| SMILES | CC(=O)OCC(C)SSCCCNC(=O)CNC(=O)CNC(=O)CNC(=O)CCCCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C24H37N5O8S2/c1-17(16-37-18(2)30)39-38-12-6-10-25-20(32)13-27-22(34)15-28-21(33)14-26-19(31)7-4-3-5-11-29-23(35)8-9-24(29)36/h8-9,17H,3-7,10-16H2,1-2H3,(H,25,32)(H,26,31)(H,27,34)(H,28,33) |
| InChIKey | YJKPYDVZXQRNLZ-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 180.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.72 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|