C29H50N4O6S2 — CID 146507151
N-[2-[[7-[3-(4,4-dimethylpentan-2-yldisulfanyl)propylamino]-7-hydroxy-2-oxoheptyl]amino]-2-oxoethyl]-6-(2,5-dioxopyrrol-1-yl)hexanamide (PubChem CID 146507151) has the molecular formula C29H50N4O6S2 and a molecular weight of 614.88 g/mol. Its IUPAC name is N-[2-[[7-[3-(4,4-dimethylpentan-2-yldisulfanyl)propylamino]-7-hydroxy-2-oxoheptyl]amino]-2-oxoethyl]-6-(2,5-dioxopyrrol-1-yl)hexanamide.
| Compound Name | N-[2-[[7-[3-(4,4-dimethylpentan-2-yldisulfanyl)propylamino]-7-hydroxy-2-oxoheptyl]amino]-2-oxoethyl]-6-(2,5-dioxopyrrol-1-yl)hexanamide |
|---|---|
| PubChem CID | 146507151 |
| Molecular Formula | C29H50N4O6S2 |
| Molecular Weight | 614.88 g/mol |
| Exact Mass | 614.32 |
| IUPAC Name | N-[2-[[7-[3-(4,4-dimethylpentan-2-yldisulfanyl)propylamino]-7-hydroxy-2-oxoheptyl]amino]-2-oxoethyl]-6-(2,5-dioxopyrrol-1-yl)hexanamide |
| SMILES | CC(CC(C)(C)C)SSCCCNC(O)CCCCC(=O)CNC(=O)CNC(=O)CCCCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C29H50N4O6S2/c1-22(19-29(2,3)4)41-40-18-10-16-30-24(35)13-8-7-11-23(34)20-31-26(37)21-32-25(36)12-6-5-9-17-33-27(38)14-15-28(33)39/h14-15,22,24,30,35H,5-13,16-21H2,1-4H3,(H,31,37)(H,32,36) |
| InChIKey | IMLQNRSLCUOWRL-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 144.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.88 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|