C15H26N2O3S2 — CID 134403434
1-[4-[[5-(disulfanyl)-5-methylhexyl]amino]-4-hydroxybutyl]pyrrole-2,5-dione (PubChem CID 134403434) has the molecular formula C15H26N2O3S2 and a molecular weight of 346.52 g/mol. Its IUPAC name is 1-[4-[[5-(disulfanyl)-5-methylhexyl]amino]-4-hydroxybutyl]pyrrole-2,5-dione.
| Compound Name | 1-[4-[[5-(disulfanyl)-5-methylhexyl]amino]-4-hydroxybutyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 134403434 |
| Molecular Formula | C15H26N2O3S2 |
| Molecular Weight | 346.52 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | 1-[4-[[5-(disulfanyl)-5-methylhexyl]amino]-4-hydroxybutyl]pyrrole-2,5-dione |
| SMILES | CC(C)(CCCCNC(O)CCCN1C(=O)C=CC1=O)SS |
| InChI | InChI=1S/C15H26N2O3S2/c1-15(2,22-21)9-3-4-10-16-12(18)6-5-11-17-13(19)7-8-14(17)20/h7-8,12,16,18,21H,3-6,9-11H2,1-2H3 |
| InChIKey | GWOQBGNIYKGFMJ-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.52 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|