C10H16N2O3 — CID 121263271
1-[3-hydroxy-3-(propylamino)propyl]pyrrole-2,5-dione (PubChem CID 121263271) has the molecular formula C10H16N2O3 and a molecular weight of 212.25 g/mol. Its IUPAC name is 1-[3-hydroxy-3-(propylamino)propyl]pyrrole-2,5-dione.
| Compound Name | 1-[3-hydroxy-3-(propylamino)propyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 121263271 |
| Molecular Formula | C10H16N2O3 |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.12 |
| IUPAC Name | 1-[3-hydroxy-3-(propylamino)propyl]pyrrole-2,5-dione |
| SMILES | CCCNC(O)CCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C10H16N2O3/c1-2-6-11-8(13)5-7-12-9(14)3-4-10(12)15/h3-4,8,11,13H,2,5-7H2,1H3 |
| InChIKey | BBMQZBUIDHBLAD-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|