C12H17N3O5 — CID 118681514
3-(2,5-dioxopyrrol-1-yl)-N-[2-(3-hydroxypropanoylamino)ethyl]propanamide (PubChem CID 118681514) has the molecular formula C12H17N3O5 and a molecular weight of 283.28 g/mol. Its IUPAC name is 3-(2,5-dioxopyrrol-1-yl)-N-[2-(3-hydroxypropanoylamino)ethyl]propanamide.
| Compound Name | 3-(2,5-dioxopyrrol-1-yl)-N-[2-(3-hydroxypropanoylamino)ethyl]propanamide |
|---|---|
| PubChem CID | 118681514 |
| Molecular Formula | C12H17N3O5 |
| Molecular Weight | 283.28 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | 3-(2,5-dioxopyrrol-1-yl)-N-[2-(3-hydroxypropanoylamino)ethyl]propanamide |
| SMILES | O=C(CCO)NCCNC(=O)CCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C12H17N3O5/c16-8-4-10(18)14-6-5-13-9(17)3-7-15-11(19)1-2-12(15)20/h1-2,16H,3-8H2,(H,13,17)(H,14,18) |
| InChIKey | DYJNTLOHNXFPSF-UHFFFAOYSA-N |
| XLogP | -2.08 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.28 |
| LogP ≤ 5 | -2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|