C11H16N2O4 — CID 90457556
6-(2,5-dioxopyrrol-1-yl)hexylcarbamic acid (PubChem CID 90457556) has the molecular formula C11H16N2O4 and a molecular weight of 240.26 g/mol. Its IUPAC name is 6-(2,5-dioxopyrrol-1-yl)hexylcarbamic acid.
| Compound Name | 6-(2,5-dioxopyrrol-1-yl)hexylcarbamic acid |
|---|---|
| PubChem CID | 90457556 |
| Molecular Formula | C11H16N2O4 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.11 |
| IUPAC Name | 6-(2,5-dioxopyrrol-1-yl)hexylcarbamic acid |
| SMILES | O=C(O)NCCCCCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C11H16N2O4/c14-9-5-6-10(15)13(9)8-4-2-1-3-7-12-11(16)17/h5-6,12H,1-4,7-8H2,(H,16,17) |
| InChIKey | QQBCGIFHOWMFQD-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|