C24H42N6O9 — CID 66832214
6-[3,5-bis[6-(carboxyamino)hexyl]-2,4,6-trioxo-1,3,5-triazinan-1-yl]hexylcarbamic acid (PubChem CID 66832214) has the molecular formula C24H42N6O9 and a molecular weight of 558.63 g/mol. Its IUPAC name is 6-[3,5-bis[6-(carboxyamino)hexyl]-2,4,6-trioxo-1,3,5-triazinan-1-yl]hexylcarbamic acid.
| Compound Name | 6-[3,5-bis[6-(carboxyamino)hexyl]-2,4,6-trioxo-1,3,5-triazinan-1-yl]hexylcarbamic acid |
|---|---|
| PubChem CID | 66832214 |
| Molecular Formula | C24H42N6O9 |
| Molecular Weight | 558.63 g/mol |
| Exact Mass | 558.30 |
| IUPAC Name | 6-[3,5-bis[6-(carboxyamino)hexyl]-2,4,6-trioxo-1,3,5-triazinan-1-yl]hexylcarbamic acid |
| SMILES | O=C(O)NCCCCCCn1c(=O)n(CCCCCCNC(=O)O)c(=O)n(CCCCCCNC(=O)O)c1=O |
| InChI | InChI=1S/C24H42N6O9/c31-19(32)25-13-7-1-4-10-16-28-22(37)29(17-11-5-2-8-14-26-20(33)34)24(39)30(23(28)38)18-12-6-3-9-15-27-21(35)36/h25-27H,1-18H2,(H,31,32)(H,33,34)(H,35,36) |
| InChIKey | UMRIFMSWIRIPRP-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 213.99 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.63 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|