C18H30N6O9 — CID 59245387
N-[3-[3,5-bis[3-[(2-hydroxyacetyl)amino]propyl]-2,4,6-trioxo-1,3,5-triazinan-1-yl]propyl]-2-hydroxyacetamide (PubChem CID 59245387) has the molecular formula C18H30N6O9 and a molecular weight of 474.47 g/mol. Its IUPAC name is N-[3-[3,5-bis[3-[(2-hydroxyacetyl)amino]propyl]-2,4,6-trioxo-1,3,5-triazinan-1-yl]propyl]-2-hydroxyacetamide.
| Compound Name | N-[3-[3,5-bis[3-[(2-hydroxyacetyl)amino]propyl]-2,4,6-trioxo-1,3,5-triazinan-1-yl]propyl]-2-hydroxyacetamide |
|---|---|
| PubChem CID | 59245387 |
| Molecular Formula | C18H30N6O9 |
| Molecular Weight | 474.47 g/mol |
| Exact Mass | 474.21 |
| IUPAC Name | N-[3-[3,5-bis[3-[(2-hydroxyacetyl)amino]propyl]-2,4,6-trioxo-1,3,5-triazinan-1-yl]propyl]-2-hydroxyacetamide |
| SMILES | O=C(CO)NCCCn1c(=O)n(CCCNC(=O)CO)c(=O)n(CCCNC(=O)CO)c1=O |
| InChI | InChI=1S/C18H30N6O9/c25-10-13(28)19-4-1-7-22-16(31)23(8-2-5-20-14(29)11-26)18(33)24(17(22)32)9-3-6-21-15(30)12-27/h25-27H,1-12H2,(H,19,28)(H,20,29)(H,21,30) |
| InChIKey | RCZNLIAXODEAMN-UHFFFAOYSA-N |
| XLogP | -5.33 |
| TPSA | 213.99 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.47 |
| LogP ≤ 5 | -5.33 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|