C20H20AcBrN3O2S — CID 20815393
actinium;N-[3-[4-(4-bromophenyl)-2-phenylimino-1,3-thiazol-3-yl]propyl]-2-hydroxyacetamide (PubChem CID 20815393) has the molecular formula C20H20AcBrN3O2S and a molecular weight of 673.37 g/mol. Its IUPAC name is actinium;N-[3-[4-(4-bromophenyl)-2-phenylimino-1,3-thiazol-3-yl]propyl]-2-hydroxyacetamide.
| Compound Name | actinium;N-[3-[4-(4-bromophenyl)-2-phenylimino-1,3-thiazol-3-yl]propyl]-2-hydroxyacetamide |
|---|---|
| PubChem CID | 20815393 |
| Molecular Formula | C20H20AcBrN3O2S |
| Molecular Weight | 673.37 g/mol |
| Exact Mass | 672.07 |
| IUPAC Name | actinium;N-[3-[4-(4-bromophenyl)-2-phenylimino-1,3-thiazol-3-yl]propyl]-2-hydroxyacetamide |
| SMILES | O=C(CO)NCCCn1c(-c2ccc(Br)cc2)cs/c1=N\c1ccccc1.[Ac] |
| InChI | InChI=1S/C20H20BrN3O2S.Ac/c21-16-9-7-15(8-10-16)18-14-27-20(23-17-5-2-1-3-6-17)24(18)12-4-11-22-19(26)13-25;/h1-3,5-10,14,25H,4,11-13H2,(H,22,26);/b23-20-; |
| InChIKey | AOHRWNLAVJAAON-QTXBERLJSA-N |
| XLogP | 3.71 |
| TPSA | 66.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.37 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|