C23H27N3O3S2 — CID 4522215
3-[2-phenylimino-4-(4-piperidin-1-ylsulfonylphenyl)-1,3-thiazol-3-yl]propan-1-ol (PubChem CID 4522215) has the molecular formula C23H27N3O3S2 and a molecular weight of 457.62 g/mol. Its IUPAC name is 3-[2-phenylimino-4-(4-piperidin-1-ylsulfonylphenyl)-1,3-thiazol-3-yl]propan-1-ol.
| Compound Name | 3-[2-phenylimino-4-(4-piperidin-1-ylsulfonylphenyl)-1,3-thiazol-3-yl]propan-1-ol |
|---|---|
| PubChem CID | 4522215 |
| Molecular Formula | C23H27N3O3S2 |
| Molecular Weight | 457.62 g/mol |
| Exact Mass | 457.15 |
| IUPAC Name | 3-[2-phenylimino-4-(4-piperidin-1-ylsulfonylphenyl)-1,3-thiazol-3-yl]propan-1-ol |
| SMILES | O=S(=O)(c1ccc(-c2cs/c(=N\c3ccccc3)n2CCCO)cc1)N1CCCCC1 |
| InChI | InChI=1S/C23H27N3O3S2/c27-17-7-16-26-22(18-30-23(26)24-20-8-3-1-4-9-20)19-10-12-21(13-11-19)31(28,29)25-14-5-2-6-15-25/h1,3-4,8-13,18,27H,2,5-7,14-17H2/b24-23- |
| InChIKey | XQAFHIXQIBFZIO-VHXPQNKSSA-N |
| XLogP | 4.01 |
| TPSA | 74.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.62 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|