C25H31N3O4S2 — CID 18812782
4-[4-(azepan-1-ylsulfonyl)phenyl]-3-(2-methoxyethyl)-N-(4-methoxyphenyl)-1,3-thiazol-2-imine (PubChem CID 18812782) has the molecular formula C25H31N3O4S2 and a molecular weight of 501.67 g/mol. Its IUPAC name is 4-[4-(azepan-1-ylsulfonyl)phenyl]-3-(2-methoxyethyl)-N-(4-methoxyphenyl)-1,3-thiazol-2-imine.
| Compound Name | 4-[4-(azepan-1-ylsulfonyl)phenyl]-3-(2-methoxyethyl)-N-(4-methoxyphenyl)-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 18812782 |
| Molecular Formula | C25H31N3O4S2 |
| Molecular Weight | 501.67 g/mol |
| Exact Mass | 501.18 |
| IUPAC Name | 4-[4-(azepan-1-ylsulfonyl)phenyl]-3-(2-methoxyethyl)-N-(4-methoxyphenyl)-1,3-thiazol-2-imine |
| SMILES | COCCn1c(-c2ccc(S(=O)(=O)N3CCCCCC3)cc2)cs/c1=N\c1ccc(OC)cc1 |
| InChI | InChI=1S/C25H31N3O4S2/c1-31-18-17-28-24(19-33-25(28)26-21-9-11-22(32-2)12-10-21)20-7-13-23(14-8-20)34(29,30)27-15-5-3-4-6-16-27/h7-14,19H,3-6,15-18H2,1-2H3/b26-25- |
| InChIKey | ZHVIZLOLOGGCPC-QPLCGJKRSA-N |
| XLogP | 4.67 |
| TPSA | 73.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.67 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|