C31H32ClF2N3O5S2 — CID 4521097
N-[4-[chloro(difluoro)methoxy]phenyl]-3-[2-(3,4-dimethoxyphenyl)ethyl]-4-(4-piperidin-1-ylsulfonylphenyl)-1,3-thiazol-2-imine (PubChem CID 4521097) has the molecular formula C31H32ClF2N3O5S2 and a molecular weight of 664.20 g/mol. Its IUPAC name is N-[4-[chloro(difluoro)methoxy]phenyl]-3-[2-(3,4-dimethoxyphenyl)ethyl]-4-(4-piperidin-1-ylsulfonylphenyl)-1,3-thiazol-2-imine.
| Compound Name | N-[4-[chloro(difluoro)methoxy]phenyl]-3-[2-(3,4-dimethoxyphenyl)ethyl]-4-(4-piperidin-1-ylsulfonylphenyl)-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 4521097 |
| Molecular Formula | C31H32ClF2N3O5S2 |
| Molecular Weight | 664.20 g/mol |
| Exact Mass | 663.14 |
| IUPAC Name | N-[4-[chloro(difluoro)methoxy]phenyl]-3-[2-(3,4-dimethoxyphenyl)ethyl]-4-(4-piperidin-1-ylsulfonylphenyl)-1,3-thiazol-2-imine |
| SMILES | COc1ccc(CCn2c(-c3ccc(S(=O)(=O)N4CCCCC4)cc3)cs/c2=N\c2ccc(OC(F)(F)Cl)cc2)cc1OC |
| InChI | InChI=1S/C31H32ClF2N3O5S2/c1-40-28-15-6-22(20-29(28)41-2)16-19-37-27(21-43-30(37)35-24-9-11-25(12-10-24)42-31(32,33)34)23-7-13-26(14-8-23)44(38,39)36-17-4-3-5-18-36/h6-15,20-21H,3-5,16-19H2,1-2H3/b35-30- |
| InChIKey | PENCEKQREFMALV-GXVXDJONSA-N |
| XLogP | 7.05 |
| TPSA | 82.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.20 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|