C23H28BrN3O3S2 — CID 146050869
N-(4-ethoxyphenyl)-3-ethyl-4-(4-pyrrolidin-1-ylsulfonylphenyl)-1,3-thiazol-2-imine;hydrobromide (PubChem CID 146050869) has the molecular formula C23H28BrN3O3S2 and a molecular weight of 538.53 g/mol. Its IUPAC name is N-(4-ethoxyphenyl)-3-ethyl-4-(4-pyrrolidin-1-ylsulfonylphenyl)-1,3-thiazol-2-imine;hydrobromide.
| Compound Name | N-(4-ethoxyphenyl)-3-ethyl-4-(4-pyrrolidin-1-ylsulfonylphenyl)-1,3-thiazol-2-imine;hydrobromide |
|---|---|
| PubChem CID | 146050869 |
| Molecular Formula | C23H28BrN3O3S2 |
| Molecular Weight | 538.53 g/mol |
| Exact Mass | 537.08 |
| IUPAC Name | N-(4-ethoxyphenyl)-3-ethyl-4-(4-pyrrolidin-1-ylsulfonylphenyl)-1,3-thiazol-2-imine;hydrobromide |
| SMILES | Br.CCOc1ccc(/N=c2\scc(-c3ccc(S(=O)(=O)N4CCCC4)cc3)n2CC)cc1 |
| InChI | InChI=1S/C23H27N3O3S2.BrH/c1-3-26-22(17-30-23(26)24-19-9-11-20(12-10-19)29-4-2)18-7-13-21(14-8-18)31(27,28)25-15-5-6-16-25;/h7-14,17H,3-6,15-16H2,1-2H3;1H/b24-23-; |
| InChIKey | KRXQLVCCXMCUQH-DCXSSQDFSA-N |
| XLogP | 5.23 |
| TPSA | 63.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.53 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|