C24H27N3O2S2 — CID 18813276
N-(4-methylphenyl)-4-(4-piperidin-1-ylsulfonylphenyl)-3-prop-2-enyl-1,3-thiazol-2-imine (PubChem CID 18813276) has the molecular formula C24H27N3O2S2 and a molecular weight of 453.63 g/mol. Its IUPAC name is N-(4-methylphenyl)-4-(4-piperidin-1-ylsulfonylphenyl)-3-prop-2-enyl-1,3-thiazol-2-imine.
| Compound Name | N-(4-methylphenyl)-4-(4-piperidin-1-ylsulfonylphenyl)-3-prop-2-enyl-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 18813276 |
| Molecular Formula | C24H27N3O2S2 |
| Molecular Weight | 453.63 g/mol |
| Exact Mass | 453.15 |
| IUPAC Name | N-(4-methylphenyl)-4-(4-piperidin-1-ylsulfonylphenyl)-3-prop-2-enyl-1,3-thiazol-2-imine |
| SMILES | C=CCn1c(-c2ccc(S(=O)(=O)N3CCCCC3)cc2)cs/c1=N\c1ccc(C)cc1 |
| InChI | InChI=1S/C24H27N3O2S2/c1-3-15-27-23(18-30-24(27)25-21-11-7-19(2)8-12-21)20-9-13-22(14-10-20)31(28,29)26-16-5-4-6-17-26/h3,7-14,18H,1,4-6,15-17H2,2H3/b25-24- |
| InChIKey | MTOCEOQWIHCLPU-IZHYLOQSSA-N |
| XLogP | 5.12 |
| TPSA | 54.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.63 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|