C25H29N3O3S2 — CID 18813116
N-(4-methylphenyl)-3-(oxolan-2-ylmethyl)-4-(4-pyrrolidin-1-ylsulfonylphenyl)-1,3-thiazol-2-imine (PubChem CID 18813116) has the molecular formula C25H29N3O3S2 and a molecular weight of 483.66 g/mol. Its IUPAC name is N-(4-methylphenyl)-3-(oxolan-2-ylmethyl)-4-(4-pyrrolidin-1-ylsulfonylphenyl)-1,3-thiazol-2-imine.
| Compound Name | N-(4-methylphenyl)-3-(oxolan-2-ylmethyl)-4-(4-pyrrolidin-1-ylsulfonylphenyl)-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 18813116 |
| Molecular Formula | C25H29N3O3S2 |
| Molecular Weight | 483.66 g/mol |
| Exact Mass | 483.17 |
| IUPAC Name | N-(4-methylphenyl)-3-(oxolan-2-ylmethyl)-4-(4-pyrrolidin-1-ylsulfonylphenyl)-1,3-thiazol-2-imine |
| SMILES | Cc1ccc(/N=c2\scc(-c3ccc(S(=O)(=O)N4CCCC4)cc3)n2CC2CCCO2)cc1 |
| InChI | InChI=1S/C25H29N3O3S2/c1-19-6-10-21(11-7-19)26-25-28(17-22-5-4-16-31-22)24(18-32-25)20-8-12-23(13-9-20)33(29,30)27-14-2-3-15-27/h6-13,18,22H,2-5,14-17H2,1H3/b26-25- |
| InChIKey | HDVMDMWPOAOLAH-QPLCGJKRSA-N |
| XLogP | 4.72 |
| TPSA | 63.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.66 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|