C21H24BrN3O2S2 — CID 126478313
3-methyl-N-(4-methylphenyl)-4-(4-pyrrolidin-1-ylsulfonylphenyl)-1,3-thiazol-2-imine;hydrobromide (PubChem CID 126478313) has the molecular formula C21H24BrN3O2S2 and a molecular weight of 494.48 g/mol. Its IUPAC name is 3-methyl-N-(4-methylphenyl)-4-(4-pyrrolidin-1-ylsulfonylphenyl)-1,3-thiazol-2-imine;hydrobromide.
| Compound Name | 3-methyl-N-(4-methylphenyl)-4-(4-pyrrolidin-1-ylsulfonylphenyl)-1,3-thiazol-2-imine;hydrobromide |
|---|---|
| PubChem CID | 126478313 |
| Molecular Formula | C21H24BrN3O2S2 |
| Molecular Weight | 494.48 g/mol |
| Exact Mass | 493.05 |
| IUPAC Name | 3-methyl-N-(4-methylphenyl)-4-(4-pyrrolidin-1-ylsulfonylphenyl)-1,3-thiazol-2-imine;hydrobromide |
| SMILES | Br.Cc1ccc(/N=c2\scc(-c3ccc(S(=O)(=O)N4CCCC4)cc3)n2C)cc1 |
| InChI | InChI=1S/C21H23N3O2S2.BrH/c1-16-5-9-18(10-6-16)22-21-23(2)20(15-27-21)17-7-11-19(12-8-17)28(25,26)24-13-3-4-14-24;/h5-12,15H,3-4,13-14H2,1-2H3;1H/b22-21-; |
| InChIKey | GYMWCMFEQYLPJA-SVXKRPBISA-N |
| XLogP | 4.66 |
| TPSA | 54.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.48 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|