C27H27BrFN3O2S2 — CID 126478252
N-(4-fluorophenyl)-3-(2-phenylethyl)-4-(4-pyrrolidin-1-ylsulfonylphenyl)-1,3-thiazol-2-imine;hydrobromide (PubChem CID 126478252) has the molecular formula C27H27BrFN3O2S2 and a molecular weight of 588.57 g/mol. Its IUPAC name is N-(4-fluorophenyl)-3-(2-phenylethyl)-4-(4-pyrrolidin-1-ylsulfonylphenyl)-1,3-thiazol-2-imine;hydrobromide.
| Compound Name | N-(4-fluorophenyl)-3-(2-phenylethyl)-4-(4-pyrrolidin-1-ylsulfonylphenyl)-1,3-thiazol-2-imine;hydrobromide |
|---|---|
| PubChem CID | 126478252 |
| Molecular Formula | C27H27BrFN3O2S2 |
| Molecular Weight | 588.57 g/mol |
| Exact Mass | 587.07 |
| IUPAC Name | N-(4-fluorophenyl)-3-(2-phenylethyl)-4-(4-pyrrolidin-1-ylsulfonylphenyl)-1,3-thiazol-2-imine;hydrobromide |
| SMILES | Br.O=S(=O)(c1ccc(-c2cs/c(=N\c3ccc(F)cc3)n2CCc2ccccc2)cc1)N1CCCC1 |
| InChI | InChI=1S/C27H26FN3O2S2.BrH/c28-23-10-12-24(13-11-23)29-27-31(19-16-21-6-2-1-3-7-21)26(20-34-27)22-8-14-25(15-9-22)35(32,33)30-17-4-5-18-30;/h1-3,6-15,20H,4-5,16-19H2;1H/b29-27-; |
| InChIKey | BETQLFGWOZPNRR-QFOGJQNBSA-N |
| XLogP | 6.19 |
| TPSA | 54.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.57 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|