C24H22FN3O3S2 — CID 3650518
N-(4-fluorophenyl)-3-(furan-2-ylmethyl)-4-(4-pyrrolidin-1-ylsulfonylphenyl)-1,3-thiazol-2-imine (PubChem CID 3650518) has the molecular formula C24H22FN3O3S2 and a molecular weight of 483.59 g/mol. Its IUPAC name is N-(4-fluorophenyl)-3-(furan-2-ylmethyl)-4-(4-pyrrolidin-1-ylsulfonylphenyl)-1,3-thiazol-2-imine.
| Compound Name | N-(4-fluorophenyl)-3-(furan-2-ylmethyl)-4-(4-pyrrolidin-1-ylsulfonylphenyl)-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 3650518 |
| Molecular Formula | C24H22FN3O3S2 |
| Molecular Weight | 483.59 g/mol |
| Exact Mass | 483.11 |
| IUPAC Name | N-(4-fluorophenyl)-3-(furan-2-ylmethyl)-4-(4-pyrrolidin-1-ylsulfonylphenyl)-1,3-thiazol-2-imine |
| SMILES | O=S(=O)(c1ccc(-c2cs/c(=N\c3ccc(F)cc3)n2Cc2ccco2)cc1)N1CCCC1 |
| InChI | InChI=1S/C24H22FN3O3S2/c25-19-7-9-20(10-8-19)26-24-28(16-21-4-3-15-31-21)23(17-32-24)18-5-11-22(12-6-18)33(29,30)27-13-1-2-14-27/h3-12,15,17H,1-2,13-14,16H2/b26-24- |
| InChIKey | GWQJIBMCUMFHDQ-LCUIJRPUSA-N |
| XLogP | 5.01 |
| TPSA | 67.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.59 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|