C22H21N3O5S2 — CID 23912501
4-(furan-2-yl)-3-(furan-2-ylmethyl)-N-(4-morpholin-4-ylsulfonylphenyl)-1,3-thiazol-2-imine (PubChem CID 23912501) has the molecular formula C22H21N3O5S2 and a molecular weight of 471.56 g/mol. Its IUPAC name is 4-(furan-2-yl)-3-(furan-2-ylmethyl)-N-(4-morpholin-4-ylsulfonylphenyl)-1,3-thiazol-2-imine.
| Compound Name | 4-(furan-2-yl)-3-(furan-2-ylmethyl)-N-(4-morpholin-4-ylsulfonylphenyl)-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 23912501 |
| Molecular Formula | C22H21N3O5S2 |
| Molecular Weight | 471.56 g/mol |
| Exact Mass | 471.09 |
| IUPAC Name | 4-(furan-2-yl)-3-(furan-2-ylmethyl)-N-(4-morpholin-4-ylsulfonylphenyl)-1,3-thiazol-2-imine |
| SMILES | O=S(=O)(c1ccc(/N=c2/scc(-c3ccco3)n2Cc2ccco2)cc1)N1CCOCC1 |
| InChI | InChI=1S/C22H21N3O5S2/c26-32(27,24-9-13-28-14-10-24)19-7-5-17(6-8-19)23-22-25(15-18-3-1-11-29-18)20(16-31-22)21-4-2-12-30-21/h1-8,11-12,16H,9-10,13-15H2/b23-22+ |
| InChIKey | STKYBVFCUARDNB-GHVJWSGMSA-N |
| XLogP | 3.70 |
| TPSA | 90.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.56 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|