C25H25N3O4S2 — CID 23769973
4-(furan-2-yl)-N-(4-morpholin-4-ylsulfonylphenyl)-3-(1-phenylethyl)-1,3-thiazol-2-imine (PubChem CID 23769973) has the molecular formula C25H25N3O4S2 and a molecular weight of 495.63 g/mol. Its IUPAC name is 4-(furan-2-yl)-N-(4-morpholin-4-ylsulfonylphenyl)-3-(1-phenylethyl)-1,3-thiazol-2-imine.
| Compound Name | 4-(furan-2-yl)-N-(4-morpholin-4-ylsulfonylphenyl)-3-(1-phenylethyl)-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 23769973 |
| Molecular Formula | C25H25N3O4S2 |
| Molecular Weight | 495.63 g/mol |
| Exact Mass | 495.13 |
| IUPAC Name | 4-(furan-2-yl)-N-(4-morpholin-4-ylsulfonylphenyl)-3-(1-phenylethyl)-1,3-thiazol-2-imine |
| SMILES | CC(c1ccccc1)n1c(-c2ccco2)cs/c1=N\c1ccc(S(=O)(=O)N2CCOCC2)cc1 |
| InChI | InChI=1S/C25H25N3O4S2/c1-19(20-6-3-2-4-7-20)28-23(24-8-5-15-32-24)18-33-25(28)26-21-9-11-22(12-10-21)34(29,30)27-13-16-31-17-14-27/h2-12,15,18-19H,13-14,16-17H2,1H3/b26-25- |
| InChIKey | VKUWUARTJJIVAA-QPLCGJKRSA-N |
| XLogP | 4.67 |
| TPSA | 77.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.63 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|