C17H23N3O3S2 — CID 23961498
4-methyl-N-(4-morpholin-4-ylsulfonylphenyl)-3-propan-2-yl-1,3-thiazol-2-imine (PubChem CID 23961498) has the molecular formula C17H23N3O3S2 and a molecular weight of 381.52 g/mol. Its IUPAC name is 4-methyl-N-(4-morpholin-4-ylsulfonylphenyl)-3-propan-2-yl-1,3-thiazol-2-imine.
| Compound Name | 4-methyl-N-(4-morpholin-4-ylsulfonylphenyl)-3-propan-2-yl-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 23961498 |
| Molecular Formula | C17H23N3O3S2 |
| Molecular Weight | 381.52 g/mol |
| Exact Mass | 381.12 |
| IUPAC Name | 4-methyl-N-(4-morpholin-4-ylsulfonylphenyl)-3-propan-2-yl-1,3-thiazol-2-imine |
| SMILES | Cc1cs/c(=N\c2ccc(S(=O)(=O)N3CCOCC3)cc2)n1C(C)C |
| InChI | InChI=1S/C17H23N3O3S2/c1-13(2)20-14(3)12-24-17(20)18-15-4-6-16(7-5-15)25(21,22)19-8-10-23-11-9-19/h4-7,12-13H,8-11H2,1-3H3/b18-17- |
| InChIKey | VXBWRCFPLHRVDW-ZCXUNETKSA-N |
| XLogP | 2.69 |
| TPSA | 63.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.52 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|