C25H27BrN4O3S2 — CID 23820462
4-(4-bromophenyl)-3-(cyclohexylideneamino)-N-(4-morpholin-4-ylsulfonylphenyl)-1,3-thiazol-2-imine (PubChem CID 23820462) has the molecular formula C25H27BrN4O3S2 and a molecular weight of 575.55 g/mol. Its IUPAC name is 4-(4-bromophenyl)-3-(cyclohexylideneamino)-N-(4-morpholin-4-ylsulfonylphenyl)-1,3-thiazol-2-imine.
| Compound Name | 4-(4-bromophenyl)-3-(cyclohexylideneamino)-N-(4-morpholin-4-ylsulfonylphenyl)-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 23820462 |
| Molecular Formula | C25H27BrN4O3S2 |
| Molecular Weight | 575.55 g/mol |
| Exact Mass | 574.07 |
| IUPAC Name | 4-(4-bromophenyl)-3-(cyclohexylideneamino)-N-(4-morpholin-4-ylsulfonylphenyl)-1,3-thiazol-2-imine |
| SMILES | O=S(=O)(c1ccc(/N=c2/scc(-c3ccc(Br)cc3)n2N=C2CCCCC2)cc1)N1CCOCC1 |
| InChI | InChI=1S/C25H27BrN4O3S2/c26-20-8-6-19(7-9-20)24-18-34-25(30(24)28-22-4-2-1-3-5-22)27-21-10-12-23(13-11-21)35(31,32)29-14-16-33-17-15-29/h6-13,18H,1-5,14-17H2/b27-25+ |
| InChIKey | XRYWUVMTPMMLCO-IMVLJIQESA-N |
| XLogP | 5.40 |
| TPSA | 76.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.55 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|