C30H38N4O6S2 — CID 23794107
3-(cyclooctylideneamino)-N-(4-morpholin-4-ylsulfonylphenyl)-4-(3,4,5-trimethoxyphenyl)-1,3-thiazol-2-imine (PubChem CID 23794107) has the molecular formula C30H38N4O6S2 and a molecular weight of 614.79 g/mol. Its IUPAC name is 3-(cyclooctylideneamino)-N-(4-morpholin-4-ylsulfonylphenyl)-4-(3,4,5-trimethoxyphenyl)-1,3-thiazol-2-imine.
| Compound Name | 3-(cyclooctylideneamino)-N-(4-morpholin-4-ylsulfonylphenyl)-4-(3,4,5-trimethoxyphenyl)-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 23794107 |
| Molecular Formula | C30H38N4O6S2 |
| Molecular Weight | 614.79 g/mol |
| Exact Mass | 614.22 |
| IUPAC Name | 3-(cyclooctylideneamino)-N-(4-morpholin-4-ylsulfonylphenyl)-4-(3,4,5-trimethoxyphenyl)-1,3-thiazol-2-imine |
| SMILES | COc1cc(-c2cs/c(=N\c3ccc(S(=O)(=O)N4CCOCC4)cc3)n2N=C2CCCCCCC2)cc(OC)c1OC |
| InChI | InChI=1S/C30H38N4O6S2/c1-37-27-19-22(20-28(38-2)29(27)39-3)26-21-41-30(34(26)32-24-9-7-5-4-6-8-10-24)31-23-11-13-25(14-12-23)42(35,36)33-15-17-40-18-16-33/h11-14,19-21H,4-10,15-18H2,1-3H3/b31-30- |
| InChIKey | SWQRIFMAXPCXGY-KTMFPKCZSA-N |
| XLogP | 5.44 |
| TPSA | 103.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.79 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|