C30H30N4O7S2 — CID 23827003
6-[3-[(3,4-dimethoxyphenyl)methyl]-2-(4-morpholin-4-ylsulfonylphenyl)imino-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one (PubChem CID 23827003) has the molecular formula C30H30N4O7S2 and a molecular weight of 622.73 g/mol. Its IUPAC name is 6-[3-[(3,4-dimethoxyphenyl)methyl]-2-(4-morpholin-4-ylsulfonylphenyl)imino-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-[3-[(3,4-dimethoxyphenyl)methyl]-2-(4-morpholin-4-ylsulfonylphenyl)imino-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 23827003 |
| Molecular Formula | C30H30N4O7S2 |
| Molecular Weight | 622.73 g/mol |
| Exact Mass | 622.16 |
| IUPAC Name | 6-[3-[(3,4-dimethoxyphenyl)methyl]-2-(4-morpholin-4-ylsulfonylphenyl)imino-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one |
| SMILES | COc1ccc(Cn2c(-c3ccc4c(c3)NC(=O)CO4)cs/c2=N\c2ccc(S(=O)(=O)N3CCOCC3)cc2)cc1OC |
| InChI | InChI=1S/C30H30N4O7S2/c1-38-27-9-3-20(15-28(27)39-2)17-34-25(21-4-10-26-24(16-21)32-29(35)18-41-26)19-42-30(34)31-22-5-7-23(8-6-22)43(36,37)33-11-13-40-14-12-33/h3-10,15-16,19H,11-14,17-18H2,1-2H3,(H,32,35)/b31-30- |
| InChIKey | HRIVVVPMNWDWAX-KTMFPKCZSA-N |
| XLogP | 3.87 |
| TPSA | 120.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.73 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|