C30H31N3O4S — CID 23794285
6-[3-[2-(3,4-dimethoxyphenyl)ethyl]-2-(4-propan-2-ylphenyl)imino-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one (PubChem CID 23794285) has the molecular formula C30H31N3O4S and a molecular weight of 529.66 g/mol. Its IUPAC name is 6-[3-[2-(3,4-dimethoxyphenyl)ethyl]-2-(4-propan-2-ylphenyl)imino-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-[3-[2-(3,4-dimethoxyphenyl)ethyl]-2-(4-propan-2-ylphenyl)imino-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 23794285 |
| Molecular Formula | C30H31N3O4S |
| Molecular Weight | 529.66 g/mol |
| Exact Mass | 529.20 |
| IUPAC Name | 6-[3-[2-(3,4-dimethoxyphenyl)ethyl]-2-(4-propan-2-ylphenyl)imino-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one |
| SMILES | COc1ccc(CCn2c(-c3ccc4c(c3)NC(=O)CO4)cs/c2=N\c2ccc(C(C)C)cc2)cc1OC |
| InChI | InChI=1S/C30H31N3O4S/c1-19(2)21-6-9-23(10-7-21)31-30-33(14-13-20-5-11-27(35-3)28(15-20)36-4)25(18-38-30)22-8-12-26-24(16-22)32-29(34)17-37-26/h5-12,15-16,18-19H,13-14,17H2,1-4H3,(H,32,34)/b31-30- |
| InChIKey | RWTLHXHXLHEXIU-KTMFPKCZSA-N |
| XLogP | 6.16 |
| TPSA | 74.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.66 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|