C25H24BrClN2O2S — CID 45135321
4-(4-chlorophenyl)-3-[2-(3,4-dimethoxyphenyl)ethyl]-N-phenyl-1,3-thiazol-2-imine;hydrobromide (PubChem CID 45135321) has the molecular formula C25H24BrClN2O2S and a molecular weight of 531.90 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-3-[2-(3,4-dimethoxyphenyl)ethyl]-N-phenyl-1,3-thiazol-2-imine;hydrobromide.
| Compound Name | 4-(4-chlorophenyl)-3-[2-(3,4-dimethoxyphenyl)ethyl]-N-phenyl-1,3-thiazol-2-imine;hydrobromide |
|---|---|
| PubChem CID | 45135321 |
| Molecular Formula | C25H24BrClN2O2S |
| Molecular Weight | 531.90 g/mol |
| Exact Mass | 530.04 |
| IUPAC Name | 4-(4-chlorophenyl)-3-[2-(3,4-dimethoxyphenyl)ethyl]-N-phenyl-1,3-thiazol-2-imine;hydrobromide |
| SMILES | Br.COc1ccc(CCn2c(-c3ccc(Cl)cc3)cs/c2=N\c2ccccc2)cc1OC |
| InChI | InChI=1S/C25H23ClN2O2S.BrH/c1-29-23-13-8-18(16-24(23)30-2)14-15-28-22(19-9-11-20(26)12-10-19)17-31-25(28)27-21-6-4-3-5-7-21;/h3-13,16-17H,14-15H2,1-2H3;1H/b27-25-; |
| InChIKey | QLJBBCXSMQGGBN-WZRSSYQVSA-N |
| XLogP | 6.94 |
| TPSA | 35.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.90 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|