C38H41N3O4S2 — CID 18813228
4-[4-(4-benzylpiperidin-1-yl)sulfonylphenyl]-3-[2-(3,4-dimethoxyphenyl)ethyl]-N-(4-methylphenyl)-1,3-thiazol-2-imine (PubChem CID 18813228) has the molecular formula C38H41N3O4S2 and a molecular weight of 667.90 g/mol. Its IUPAC name is 4-[4-(4-benzylpiperidin-1-yl)sulfonylphenyl]-3-[2-(3,4-dimethoxyphenyl)ethyl]-N-(4-methylphenyl)-1,3-thiazol-2-imine.
| Compound Name | 4-[4-(4-benzylpiperidin-1-yl)sulfonylphenyl]-3-[2-(3,4-dimethoxyphenyl)ethyl]-N-(4-methylphenyl)-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 18813228 |
| Molecular Formula | C38H41N3O4S2 |
| Molecular Weight | 667.90 g/mol |
| Exact Mass | 667.25 |
| IUPAC Name | 4-[4-(4-benzylpiperidin-1-yl)sulfonylphenyl]-3-[2-(3,4-dimethoxyphenyl)ethyl]-N-(4-methylphenyl)-1,3-thiazol-2-imine |
| SMILES | COc1ccc(CCn2c(-c3ccc(S(=O)(=O)N4CCC(Cc5ccccc5)CC4)cc3)cs/c2=N\c2ccc(C)cc2)cc1OC |
| InChI | InChI=1S/C38H41N3O4S2/c1-28-9-14-33(15-10-28)39-38-41(24-21-30-11-18-36(44-2)37(26-30)45-3)35(27-46-38)32-12-16-34(17-13-32)47(42,43)40-22-19-31(20-23-40)25-29-7-5-4-6-8-29/h4-18,26-27,31H,19-25H2,1-3H3/b39-38- |
| InChIKey | WESSBXCIMJVVFC-OKULSNQLSA-N |
| XLogP | 7.66 |
| TPSA | 73.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.90 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|