C29H31N3O2S2 — CID 5245422
4-[4-(4-benzylpiperidin-1-yl)sulfonylphenyl]-3-ethyl-N-phenyl-1,3-thiazol-2-imine (PubChem CID 5245422) has the molecular formula C29H31N3O2S2 and a molecular weight of 517.72 g/mol. Its IUPAC name is 4-[4-(4-benzylpiperidin-1-yl)sulfonylphenyl]-3-ethyl-N-phenyl-1,3-thiazol-2-imine.
| Compound Name | 4-[4-(4-benzylpiperidin-1-yl)sulfonylphenyl]-3-ethyl-N-phenyl-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 5245422 |
| Molecular Formula | C29H31N3O2S2 |
| Molecular Weight | 517.72 g/mol |
| Exact Mass | 517.19 |
| IUPAC Name | 4-[4-(4-benzylpiperidin-1-yl)sulfonylphenyl]-3-ethyl-N-phenyl-1,3-thiazol-2-imine |
| SMILES | CCn1c(-c2ccc(S(=O)(=O)N3CCC(Cc4ccccc4)CC3)cc2)cs/c1=N\c1ccccc1 |
| InChI | InChI=1S/C29H31N3O2S2/c1-2-32-28(22-35-29(32)30-26-11-7-4-8-12-26)25-13-15-27(16-14-25)36(33,34)31-19-17-24(18-20-31)21-23-9-5-3-6-10-23/h3-16,22,24H,2,17-21H2,1H3/b30-29- |
| InChIKey | PCEOPDSBGOXWJE-FLWNBWAVSA-N |
| XLogP | 6.11 |
| TPSA | 54.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.72 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|