C30H31N3O2S2 — CID 5120641
4-[4-(4-benzylpiperidin-1-yl)sulfonylphenyl]-N-phenyl-3-prop-2-enyl-1,3-thiazol-2-imine (PubChem CID 5120641) has the molecular formula C30H31N3O2S2 and a molecular weight of 529.73 g/mol. Its IUPAC name is 4-[4-(4-benzylpiperidin-1-yl)sulfonylphenyl]-N-phenyl-3-prop-2-enyl-1,3-thiazol-2-imine.
| Compound Name | 4-[4-(4-benzylpiperidin-1-yl)sulfonylphenyl]-N-phenyl-3-prop-2-enyl-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 5120641 |
| Molecular Formula | C30H31N3O2S2 |
| Molecular Weight | 529.73 g/mol |
| Exact Mass | 529.19 |
| IUPAC Name | 4-[4-(4-benzylpiperidin-1-yl)sulfonylphenyl]-N-phenyl-3-prop-2-enyl-1,3-thiazol-2-imine |
| SMILES | C=CCn1c(-c2ccc(S(=O)(=O)N3CCC(Cc4ccccc4)CC3)cc2)cs/c1=N\c1ccccc1 |
| InChI | InChI=1S/C30H31N3O2S2/c1-2-19-33-29(23-36-30(33)31-27-11-7-4-8-12-27)26-13-15-28(16-14-26)37(34,35)32-20-17-25(18-21-32)22-24-9-5-3-6-10-24/h2-16,23,25H,1,17-22H2/b31-30- |
| InChIKey | NZVOHTATDRYKGB-KTMFPKCZSA-N |
| XLogP | 6.28 |
| TPSA | 54.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.73 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|