C23H28BrN3O2S2 — CID 90484821
3-(2-methylpropyl)-N-phenyl-4-(4-pyrrolidin-1-ylsulfonylphenyl)-1,3-thiazol-2-imine;hydrobromide (PubChem CID 90484821) has the molecular formula C23H28BrN3O2S2 and a molecular weight of 522.53 g/mol. Its IUPAC name is 3-(2-methylpropyl)-N-phenyl-4-(4-pyrrolidin-1-ylsulfonylphenyl)-1,3-thiazol-2-imine;hydrobromide.
| Compound Name | 3-(2-methylpropyl)-N-phenyl-4-(4-pyrrolidin-1-ylsulfonylphenyl)-1,3-thiazol-2-imine;hydrobromide |
|---|---|
| PubChem CID | 90484821 |
| Molecular Formula | C23H28BrN3O2S2 |
| Molecular Weight | 522.53 g/mol |
| Exact Mass | 521.08 |
| IUPAC Name | 3-(2-methylpropyl)-N-phenyl-4-(4-pyrrolidin-1-ylsulfonylphenyl)-1,3-thiazol-2-imine;hydrobromide |
| SMILES | Br.CC(C)Cn1c(-c2ccc(S(=O)(=O)N3CCCC3)cc2)cs/c1=N\c1ccccc1 |
| InChI | InChI=1S/C23H27N3O2S2.BrH/c1-18(2)16-26-22(17-29-23(26)24-20-8-4-3-5-9-20)19-10-12-21(13-11-19)30(27,28)25-14-6-7-15-25;/h3-5,8-13,17-18H,6-7,14-16H2,1-2H3;1H/b24-23-; |
| InChIKey | BDTUJYUAYXODTG-DCXSSQDFSA-N |
| XLogP | 5.47 |
| TPSA | 54.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.53 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|