C29H31N3O3S2 — CID 18812740
N-(4-methoxyphenyl)-3-(2-phenylethyl)-4-(4-piperidin-1-ylsulfonylphenyl)-1,3-thiazol-2-imine (PubChem CID 18812740) has the molecular formula C29H31N3O3S2 and a molecular weight of 533.72 g/mol. Its IUPAC name is N-(4-methoxyphenyl)-3-(2-phenylethyl)-4-(4-piperidin-1-ylsulfonylphenyl)-1,3-thiazol-2-imine.
| Compound Name | N-(4-methoxyphenyl)-3-(2-phenylethyl)-4-(4-piperidin-1-ylsulfonylphenyl)-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 18812740 |
| Molecular Formula | C29H31N3O3S2 |
| Molecular Weight | 533.72 g/mol |
| Exact Mass | 533.18 |
| IUPAC Name | N-(4-methoxyphenyl)-3-(2-phenylethyl)-4-(4-piperidin-1-ylsulfonylphenyl)-1,3-thiazol-2-imine |
| SMILES | COc1ccc(/N=c2\scc(-c3ccc(S(=O)(=O)N4CCCCC4)cc3)n2CCc2ccccc2)cc1 |
| InChI | InChI=1S/C29H31N3O3S2/c1-35-26-14-12-25(13-15-26)30-29-32(21-18-23-8-4-2-5-9-23)28(22-36-29)24-10-16-27(17-11-24)37(33,34)31-19-6-3-7-20-31/h2,4-5,8-17,22H,3,6-7,18-21H2,1H3/b30-29- |
| InChIKey | NXZIOATYOROGBN-FLWNBWAVSA-N |
| XLogP | 5.87 |
| TPSA | 63.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.72 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|