C32H37N3O2S2 — CID 5229088
4-[4-(4-benzylpiperidin-1-yl)sulfonylphenyl]-3-pentyl-N-phenyl-1,3-thiazol-2-imine (PubChem CID 5229088) has the molecular formula C32H37N3O2S2 and a molecular weight of 559.80 g/mol. Its IUPAC name is 4-[4-(4-benzylpiperidin-1-yl)sulfonylphenyl]-3-pentyl-N-phenyl-1,3-thiazol-2-imine.
| Compound Name | 4-[4-(4-benzylpiperidin-1-yl)sulfonylphenyl]-3-pentyl-N-phenyl-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 5229088 |
| Molecular Formula | C32H37N3O2S2 |
| Molecular Weight | 559.80 g/mol |
| Exact Mass | 559.23 |
| IUPAC Name | 4-[4-(4-benzylpiperidin-1-yl)sulfonylphenyl]-3-pentyl-N-phenyl-1,3-thiazol-2-imine |
| SMILES | CCCCCn1c(-c2ccc(S(=O)(=O)N3CCC(Cc4ccccc4)CC3)cc2)cs/c1=N\c1ccccc1 |
| InChI | InChI=1S/C32H37N3O2S2/c1-2-3-10-21-35-31(25-38-32(35)33-29-13-8-5-9-14-29)28-15-17-30(18-16-28)39(36,37)34-22-19-27(20-23-34)24-26-11-6-4-7-12-26/h4-9,11-18,25,27H,2-3,10,19-24H2,1H3/b33-32- |
| InChIKey | DDCLHLJPJUIEKA-KARKAFJISA-N |
| XLogP | 7.28 |
| TPSA | 54.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.80 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|