C25H18FN3O4S — CID 23739058
6-[3-(1,3-benzodioxol-5-ylmethyl)-2-(4-fluorophenyl)imino-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one (PubChem CID 23739058) has the molecular formula C25H18FN3O4S and a molecular weight of 475.50 g/mol. Its IUPAC name is 6-[3-(1,3-benzodioxol-5-ylmethyl)-2-(4-fluorophenyl)imino-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-[3-(1,3-benzodioxol-5-ylmethyl)-2-(4-fluorophenyl)imino-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 23739058 |
| Molecular Formula | C25H18FN3O4S |
| Molecular Weight | 475.50 g/mol |
| Exact Mass | 475.10 |
| IUPAC Name | 6-[3-(1,3-benzodioxol-5-ylmethyl)-2-(4-fluorophenyl)imino-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one |
| SMILES | O=C1COc2ccc(-c3cs/c(=N\c4ccc(F)cc4)n3Cc3ccc4c(c3)OCO4)cc2N1 |
| InChI | InChI=1S/C25H18FN3O4S/c26-17-3-5-18(6-4-17)27-25-29(11-15-1-7-22-23(9-15)33-14-32-22)20(13-34-25)16-2-8-21-19(10-16)28-24(30)12-31-21/h1-10,13H,11-12,14H2,(H,28,30)/b27-25- |
| InChIKey | SGGCVPUNXBBOJI-RFBIWTDZSA-N |
| XLogP | 4.70 |
| TPSA | 74.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.50 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|