C23H17FN4O3S — CID 23732790
6-[2-(4-fluorophenyl)imino-3-[(5-methylfuran-2-yl)methylideneamino]-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one (PubChem CID 23732790) has the molecular formula C23H17FN4O3S and a molecular weight of 448.48 g/mol. Its IUPAC name is 6-[2-(4-fluorophenyl)imino-3-[(5-methylfuran-2-yl)methylideneamino]-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-[2-(4-fluorophenyl)imino-3-[(5-methylfuran-2-yl)methylideneamino]-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 23732790 |
| Molecular Formula | C23H17FN4O3S |
| Molecular Weight | 448.48 g/mol |
| Exact Mass | 448.10 |
| IUPAC Name | 6-[2-(4-fluorophenyl)imino-3-[(5-methylfuran-2-yl)methylideneamino]-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one |
| SMILES | Cc1ccc(C=Nn2c(-c3ccc4c(c3)NC(=O)CO4)cs/c2=N\c2ccc(F)cc2)o1 |
| InChI | InChI=1S/C23H17FN4O3S/c1-14-2-8-18(31-14)11-25-28-20(13-32-23(28)26-17-6-4-16(24)5-7-17)15-3-9-21-19(10-15)27-22(29)12-30-21/h2-11,13H,12H2,1H3,(H,27,29)/b25-11?,26-23- |
| InChIKey | FUFKTIIXWGDPAM-BFUNBBSWSA-N |
| XLogP | 4.70 |
| TPSA | 81.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.48 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|