C26H22N4O5S — CID 135847417
6-[2-(2,4-dimethylphenyl)imino-3-[(2,3,4-trihydroxyphenyl)methylideneamino]-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one (PubChem CID 135847417) has the molecular formula C26H22N4O5S and a molecular weight of 502.55 g/mol. Its IUPAC name is 6-[2-(2,4-dimethylphenyl)imino-3-[(2,3,4-trihydroxyphenyl)methylideneamino]-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-[2-(2,4-dimethylphenyl)imino-3-[(2,3,4-trihydroxyphenyl)methylideneamino]-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 135847417 |
| Molecular Formula | C26H22N4O5S |
| Molecular Weight | 502.55 g/mol |
| Exact Mass | 502.13 |
| IUPAC Name | 6-[2-(2,4-dimethylphenyl)imino-3-[(2,3,4-trihydroxyphenyl)methylideneamino]-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one |
| SMILES | Cc1ccc(/N=c2\scc(-c3ccc4c(c3)NC(=O)CO4)n2N=Cc2ccc(O)c(O)c2O)c(C)c1 |
| InChI | InChI=1S/C26H22N4O5S/c1-14-3-6-18(15(2)9-14)29-26-30(27-11-17-4-7-21(31)25(34)24(17)33)20(13-36-26)16-5-8-22-19(10-16)28-23(32)12-35-22/h3-11,13,31,33-34H,12H2,1-2H3,(H,28,32)/b27-11?,29-26- |
| InChIKey | WOGHLRGXDPJTKN-OLLZKBLFSA-N |
| XLogP | 4.40 |
| TPSA | 128.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.55 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|