C19H14Br2N4O3S — CID 135605628
6-[3-[(3,5-dibromo-2-hydroxyphenyl)methylideneamino]-2-methylimino-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one (PubChem CID 135605628) has the molecular formula C19H14Br2N4O3S and a molecular weight of 538.22 g/mol. Its IUPAC name is 6-[3-[(3,5-dibromo-2-hydroxyphenyl)methylideneamino]-2-methylimino-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-[3-[(3,5-dibromo-2-hydroxyphenyl)methylideneamino]-2-methylimino-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 135605628 |
| Molecular Formula | C19H14Br2N4O3S |
| Molecular Weight | 538.22 g/mol |
| Exact Mass | 535.92 |
| IUPAC Name | 6-[3-[(3,5-dibromo-2-hydroxyphenyl)methylideneamino]-2-methylimino-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one |
| SMILES | C/N=c1\scc(-c2ccc3c(c2)NC(=O)CO3)n1N=Cc1cc(Br)cc(Br)c1O |
| InChI | InChI=1S/C19H14Br2N4O3S/c1-22-19-25(23-7-11-4-12(20)6-13(21)18(11)27)15(9-29-19)10-2-3-16-14(5-10)24-17(26)8-28-16/h2-7,9,27H,8H2,1H3,(H,24,26)/b22-19-,23-7? |
| InChIKey | CTSSEGGEUJZODR-SWMXWNEGSA-N |
| XLogP | 4.19 |
| TPSA | 88.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.22 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|