C19H18N4O2S2 — CID 23761990
6-[2-propan-2-ylimino-3-(thiophen-2-ylmethylideneamino)-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one (PubChem CID 23761990) has the molecular formula C19H18N4O2S2 and a molecular weight of 398.51 g/mol. Its IUPAC name is 6-[2-propan-2-ylimino-3-(thiophen-2-ylmethylideneamino)-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-[2-propan-2-ylimino-3-(thiophen-2-ylmethylideneamino)-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 23761990 |
| Molecular Formula | C19H18N4O2S2 |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.09 |
| IUPAC Name | 6-[2-propan-2-ylimino-3-(thiophen-2-ylmethylideneamino)-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one |
| SMILES | CC(C)/N=c1\scc(-c2ccc3c(c2)NC(=O)CO3)n1N=Cc1cccs1 |
| InChI | InChI=1S/C19H18N4O2S2/c1-12(2)21-19-23(20-9-14-4-3-7-26-14)16(11-27-19)13-5-6-17-15(8-13)22-18(24)10-25-17/h3-9,11-12H,10H2,1-2H3,(H,22,24)/b20-9?,21-19- |
| InChIKey | NTWIRRWMXCITSD-SLCXLSTKSA-N |
| XLogP | 3.80 |
| TPSA | 67.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|