C23H24N4O3S — CID 23880747
6-[3-[(2-ethoxyphenyl)methylideneamino]-2-propan-2-ylimino-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one (PubChem CID 23880747) has the molecular formula C23H24N4O3S and a molecular weight of 436.54 g/mol. Its IUPAC name is 6-[3-[(2-ethoxyphenyl)methylideneamino]-2-propan-2-ylimino-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-[3-[(2-ethoxyphenyl)methylideneamino]-2-propan-2-ylimino-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 23880747 |
| Molecular Formula | C23H24N4O3S |
| Molecular Weight | 436.54 g/mol |
| Exact Mass | 436.16 |
| IUPAC Name | 6-[3-[(2-ethoxyphenyl)methylideneamino]-2-propan-2-ylimino-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one |
| SMILES | CCOc1ccccc1C=Nn1c(-c2ccc3c(c2)NC(=O)CO3)cs/c1=N\C(C)C |
| InChI | InChI=1S/C23H24N4O3S/c1-4-29-20-8-6-5-7-17(20)12-24-27-19(14-31-23(27)25-15(2)3)16-9-10-21-18(11-16)26-22(28)13-30-21/h5-12,14-15H,4,13H2,1-3H3,(H,26,28)/b24-12?,25-23- |
| InChIKey | SDQQHZBFDUWJJP-AXGQSJLKSA-N |
| XLogP | 4.14 |
| TPSA | 77.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.54 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|