C21H20N4O4S — CID 135610280
6-[3-[(2,4-dihydroxyphenyl)methylideneamino]-2-propan-2-ylimino-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one (PubChem CID 135610280) has the molecular formula C21H20N4O4S and a molecular weight of 424.48 g/mol. Its IUPAC name is 6-[3-[(2,4-dihydroxyphenyl)methylideneamino]-2-propan-2-ylimino-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-[3-[(2,4-dihydroxyphenyl)methylideneamino]-2-propan-2-ylimino-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 135610280 |
| Molecular Formula | C21H20N4O4S |
| Molecular Weight | 424.48 g/mol |
| Exact Mass | 424.12 |
| IUPAC Name | 6-[3-[(2,4-dihydroxyphenyl)methylideneamino]-2-propan-2-ylimino-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one |
| SMILES | CC(C)/N=c1\scc(-c2ccc3c(c2)NC(=O)CO3)n1N=Cc1ccc(O)cc1O |
| InChI | InChI=1S/C21H20N4O4S/c1-12(2)23-21-25(22-9-14-3-5-15(26)8-18(14)27)17(11-30-21)13-4-6-19-16(7-13)24-20(28)10-29-19/h3-9,11-12,26-27H,10H2,1-2H3,(H,24,28)/b22-9?,23-21- |
| InChIKey | LWQYEQIAYBPPKQ-CHJTZDEGSA-N |
| XLogP | 3.15 |
| TPSA | 108.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.48 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|