C18H16N4O2S2 — CID 23913364
6-[2-ethylimino-3-(thiophen-3-ylmethylideneamino)-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one (PubChem CID 23913364) has the molecular formula C18H16N4O2S2 and a molecular weight of 384.49 g/mol. Its IUPAC name is 6-[2-ethylimino-3-(thiophen-3-ylmethylideneamino)-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-[2-ethylimino-3-(thiophen-3-ylmethylideneamino)-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 23913364 |
| Molecular Formula | C18H16N4O2S2 |
| Molecular Weight | 384.49 g/mol |
| Exact Mass | 384.07 |
| IUPAC Name | 6-[2-ethylimino-3-(thiophen-3-ylmethylideneamino)-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one |
| SMILES | CC/N=c1\scc(-c2ccc3c(c2)NC(=O)CO3)n1N=Cc1ccsc1 |
| InChI | InChI=1S/C18H16N4O2S2/c1-2-19-18-22(20-8-12-5-6-25-10-12)15(11-26-18)13-3-4-16-14(7-13)21-17(23)9-24-16/h3-8,10-11H,2,9H2,1H3,(H,21,23)/b19-18-,20-8? |
| InChIKey | QHSWDFJGYSYPSO-RIIQAVGBSA-N |
| XLogP | 3.41 |
| TPSA | 67.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.49 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|