C24H20N4O2S2 — CID 23932224
6-[2-(2,3-dimethylphenyl)imino-3-(thiophen-3-ylmethylideneamino)-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one (PubChem CID 23932224) has the molecular formula C24H20N4O2S2 and a molecular weight of 460.58 g/mol. Its IUPAC name is 6-[2-(2,3-dimethylphenyl)imino-3-(thiophen-3-ylmethylideneamino)-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-[2-(2,3-dimethylphenyl)imino-3-(thiophen-3-ylmethylideneamino)-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 23932224 |
| Molecular Formula | C24H20N4O2S2 |
| Molecular Weight | 460.58 g/mol |
| Exact Mass | 460.10 |
| IUPAC Name | 6-[2-(2,3-dimethylphenyl)imino-3-(thiophen-3-ylmethylideneamino)-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one |
| SMILES | Cc1cccc(/N=c2\scc(-c3ccc4c(c3)NC(=O)CO4)n2N=Cc2ccsc2)c1C |
| InChI | InChI=1S/C24H20N4O2S2/c1-15-4-3-5-19(16(15)2)27-24-28(25-11-17-8-9-31-13-17)21(14-32-24)18-6-7-22-20(10-18)26-23(29)12-30-22/h3-11,13-14H,12H2,1-2H3,(H,26,29)/b25-11?,27-24- |
| InChIKey | POQOCDHYTXUTHB-CWRGEDHZSA-N |
| XLogP | 5.34 |
| TPSA | 67.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.58 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|