C25H19BrN4O2S — CID 23910824
6-[2-benzylimino-3-[(3-bromophenyl)methylideneamino]-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one (PubChem CID 23910824) has the molecular formula C25H19BrN4O2S and a molecular weight of 519.42 g/mol. Its IUPAC name is 6-[2-benzylimino-3-[(3-bromophenyl)methylideneamino]-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-[2-benzylimino-3-[(3-bromophenyl)methylideneamino]-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 23910824 |
| Molecular Formula | C25H19BrN4O2S |
| Molecular Weight | 519.42 g/mol |
| Exact Mass | 518.04 |
| IUPAC Name | 6-[2-benzylimino-3-[(3-bromophenyl)methylideneamino]-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one |
| SMILES | O=C1COc2ccc(-c3cs/c(=N\Cc4ccccc4)n3N=Cc3cccc(Br)c3)cc2N1 |
| InChI | InChI=1S/C25H19BrN4O2S/c26-20-8-4-7-18(11-20)14-28-30-22(16-33-25(30)27-13-17-5-2-1-3-6-17)19-9-10-23-21(12-19)29-24(31)15-32-23/h1-12,14,16H,13,15H2,(H,29,31)/b27-25-,28-14? |
| InChIKey | UNNCBAWEUZXAQO-ODHDWKIKSA-N |
| XLogP | 5.29 |
| TPSA | 67.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.42 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|