C17H12Br2ClN3OS — CID 135704241
2,4-dibromo-6-[[4-(4-chlorophenyl)-2-methylimino-1,3-thiazol-3-yl]iminomethyl]phenol (PubChem CID 135704241) has the molecular formula C17H12Br2ClN3OS and a molecular weight of 501.63 g/mol. Its IUPAC name is 2,4-dibromo-6-[[4-(4-chlorophenyl)-2-methylimino-1,3-thiazol-3-yl]iminomethyl]phenol.
| Compound Name | 2,4-dibromo-6-[[4-(4-chlorophenyl)-2-methylimino-1,3-thiazol-3-yl]iminomethyl]phenol |
|---|---|
| PubChem CID | 135704241 |
| Molecular Formula | C17H12Br2ClN3OS |
| Molecular Weight | 501.63 g/mol |
| Exact Mass | 498.88 |
| IUPAC Name | 2,4-dibromo-6-[[4-(4-chlorophenyl)-2-methylimino-1,3-thiazol-3-yl]iminomethyl]phenol |
| SMILES | C/N=c1\scc(-c2ccc(Cl)cc2)n1N=Cc1cc(Br)cc(Br)c1O |
| InChI | InChI=1S/C17H12Br2ClN3OS/c1-21-17-23(15(9-25-17)10-2-4-13(20)5-3-10)22-8-11-6-12(18)7-14(19)16(11)24/h2-9,24H,1H3/b21-17-,22-8? |
| InChIKey | SSVHCZNULFHFLD-IAFLVQFVSA-N |
| XLogP | 5.51 |
| TPSA | 49.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.63 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|