C17H14BrN3O2S — CID 135691194
3-[(E)-[4-(3-bromophenyl)-2-methylimino-1,3-thiazol-3-yl]iminomethyl]benzene-1,2-diol (PubChem CID 135691194) has the molecular formula C17H14BrN3O2S and a molecular weight of 404.29 g/mol. Its IUPAC name is 3-[(E)-[4-(3-bromophenyl)-2-methylimino-1,3-thiazol-3-yl]iminomethyl]benzene-1,2-diol.
| Compound Name | 3-[(E)-[4-(3-bromophenyl)-2-methylimino-1,3-thiazol-3-yl]iminomethyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 135691194 |
| Molecular Formula | C17H14BrN3O2S |
| Molecular Weight | 404.29 g/mol |
| Exact Mass | 403.00 |
| IUPAC Name | 3-[(E)-[4-(3-bromophenyl)-2-methylimino-1,3-thiazol-3-yl]iminomethyl]benzene-1,2-diol |
| SMILES | C/N=c1\scc(-c2cccc(Br)c2)n1/N=C/c1cccc(O)c1O |
| InChI | InChI=1S/C17H14BrN3O2S/c1-19-17-21(20-9-12-5-3-7-15(22)16(12)23)14(10-24-17)11-4-2-6-13(18)8-11/h2-10,22-23H,1H3/b19-17-,20-9+ |
| InChIKey | ALWDBCPGGIEYRA-RZWFVBBUSA-N |
| XLogP | 3.80 |
| TPSA | 70.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.29 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|