C17H12Br2N4O3S — CID 136799832
2,4-dibromo-6-[(Z)-[2-methylimino-4-(4-nitrophenyl)-1,3-thiazol-3-yl]iminomethyl]phenol (PubChem CID 136799832) has the molecular formula C17H12Br2N4O3S and a molecular weight of 512.18 g/mol. Its IUPAC name is 2,4-dibromo-6-[(Z)-[2-methylimino-4-(4-nitrophenyl)-1,3-thiazol-3-yl]iminomethyl]phenol.
| Compound Name | 2,4-dibromo-6-[(Z)-[2-methylimino-4-(4-nitrophenyl)-1,3-thiazol-3-yl]iminomethyl]phenol |
|---|---|
| PubChem CID | 136799832 |
| Molecular Formula | C17H12Br2N4O3S |
| Molecular Weight | 512.18 g/mol |
| Exact Mass | 509.90 |
| IUPAC Name | 2,4-dibromo-6-[(Z)-[2-methylimino-4-(4-nitrophenyl)-1,3-thiazol-3-yl]iminomethyl]phenol |
| SMILES | C/N=c1\scc(-c2ccc([N+](=O)[O-])cc2)n1/N=C\c1cc(Br)cc(Br)c1O |
| InChI | InChI=1S/C17H12Br2N4O3S/c1-20-17-22(21-8-11-6-12(18)7-14(19)16(11)24)15(9-27-17)10-2-4-13(5-3-10)23(25)26/h2-9,24H,1H3/b20-17-,21-8- |
| InChIKey | XVLYNKASPHQQDG-WFUIONGSSA-N |
| XLogP | 4.77 |
| TPSA | 93.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.18 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|