C15H11BrN4O3S — CID 7975149
(Z)-4-(4-bromophenyl)-N-methyl-3-[(Z)-(5-nitrofuran-2-yl)methylideneamino]-1,3-thiazol-2-imine (PubChem CID 7975149) has the molecular formula C15H11BrN4O3S and a molecular weight of 407.25 g/mol. Its IUPAC name is (Z)-4-(4-bromophenyl)-N-methyl-3-[(Z)-(5-nitrofuran-2-yl)methylideneamino]-1,3-thiazol-2-imine.
| Compound Name | (Z)-4-(4-bromophenyl)-N-methyl-3-[(Z)-(5-nitrofuran-2-yl)methylideneamino]-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 7975149 |
| Molecular Formula | C15H11BrN4O3S |
| Molecular Weight | 407.25 g/mol |
| Exact Mass | 405.97 |
| IUPAC Name | (Z)-4-(4-bromophenyl)-N-methyl-3-[(Z)-(5-nitrofuran-2-yl)methylideneamino]-1,3-thiazol-2-imine |
| SMILES | C/N=c1\scc(-c2ccc(Br)cc2)n1/N=C\c1ccc([N+](=O)[O-])o1 |
| InChI | InChI=1S/C15H11BrN4O3S/c1-17-15-19(18-8-12-6-7-14(23-12)20(21)22)13(9-24-15)10-2-4-11(16)5-3-10/h2-9H,1H3/b17-15-,18-8- |
| InChIKey | GVFIUUJMVPXIED-WSHHSOPGSA-N |
| XLogP | 3.89 |
| TPSA | 85.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.25 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|