C20H14N4O3S — CID 23908093
3-[(5-nitrofuran-2-yl)methylideneamino]-N,4-diphenyl-1,3-thiazol-2-imine (PubChem CID 23908093) has the molecular formula C20H14N4O3S and a molecular weight of 390.42 g/mol. Its IUPAC name is 3-[(5-nitrofuran-2-yl)methylideneamino]-N,4-diphenyl-1,3-thiazol-2-imine.
| Compound Name | 3-[(5-nitrofuran-2-yl)methylideneamino]-N,4-diphenyl-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 23908093 |
| Molecular Formula | C20H14N4O3S |
| Molecular Weight | 390.42 g/mol |
| Exact Mass | 390.08 |
| IUPAC Name | 3-[(5-nitrofuran-2-yl)methylideneamino]-N,4-diphenyl-1,3-thiazol-2-imine |
| SMILES | O=[N+]([O-])c1ccc(C=Nn2c(-c3ccccc3)cs/c2=N\c2ccccc2)o1 |
| InChI | InChI=1S/C20H14N4O3S/c25-24(26)19-12-11-17(27-19)13-21-23-18(15-7-3-1-4-8-15)14-28-20(23)22-16-9-5-2-6-10-16/h1-14H/b21-13?,22-20- |
| InChIKey | LTABTFQEQKVKHP-UFCRRRKQSA-N |
| XLogP | 4.83 |
| TPSA | 85.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.42 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|