C20H12F2N4O3S — CID 23790253
4-(2-fluorophenyl)-N-(4-fluorophenyl)-3-[(5-nitrofuran-2-yl)methylideneamino]-1,3-thiazol-2-imine (PubChem CID 23790253) has the molecular formula C20H12F2N4O3S and a molecular weight of 426.40 g/mol. Its IUPAC name is 4-(2-fluorophenyl)-N-(4-fluorophenyl)-3-[(5-nitrofuran-2-yl)methylideneamino]-1,3-thiazol-2-imine.
| Compound Name | 4-(2-fluorophenyl)-N-(4-fluorophenyl)-3-[(5-nitrofuran-2-yl)methylideneamino]-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 23790253 |
| Molecular Formula | C20H12F2N4O3S |
| Molecular Weight | 426.40 g/mol |
| Exact Mass | 426.06 |
| IUPAC Name | 4-(2-fluorophenyl)-N-(4-fluorophenyl)-3-[(5-nitrofuran-2-yl)methylideneamino]-1,3-thiazol-2-imine |
| SMILES | O=[N+]([O-])c1ccc(C=Nn2c(-c3ccccc3F)cs/c2=N\c2ccc(F)cc2)o1 |
| InChI | InChI=1S/C20H12F2N4O3S/c21-13-5-7-14(8-6-13)24-20-25(23-11-15-9-10-19(29-15)26(27)28)18(12-30-20)16-3-1-2-4-17(16)22/h1-12H/b23-11?,24-20- |
| InChIKey | OEOBJNZWZBTZMU-SIQQMNMFSA-N |
| XLogP | 5.11 |
| TPSA | 85.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.40 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|