C23H20N4O6S — CID 23903751
4-(2,5-dimethoxyphenyl)-N-(3-methoxyphenyl)-3-[(5-nitrofuran-2-yl)methylideneamino]-1,3-thiazol-2-imine (PubChem CID 23903751) has the molecular formula C23H20N4O6S and a molecular weight of 480.50 g/mol. Its IUPAC name is 4-(2,5-dimethoxyphenyl)-N-(3-methoxyphenyl)-3-[(5-nitrofuran-2-yl)methylideneamino]-1,3-thiazol-2-imine.
| Compound Name | 4-(2,5-dimethoxyphenyl)-N-(3-methoxyphenyl)-3-[(5-nitrofuran-2-yl)methylideneamino]-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 23903751 |
| Molecular Formula | C23H20N4O6S |
| Molecular Weight | 480.50 g/mol |
| Exact Mass | 480.11 |
| IUPAC Name | 4-(2,5-dimethoxyphenyl)-N-(3-methoxyphenyl)-3-[(5-nitrofuran-2-yl)methylideneamino]-1,3-thiazol-2-imine |
| SMILES | COc1cccc(/N=c2\scc(-c3cc(OC)ccc3OC)n2N=Cc2ccc([N+](=O)[O-])o2)c1 |
| InChI | InChI=1S/C23H20N4O6S/c1-30-16-6-4-5-15(11-16)25-23-26(24-13-18-8-10-22(33-18)27(28)29)20(14-34-23)19-12-17(31-2)7-9-21(19)32-3/h4-14H,1-3H3/b24-13?,25-23- |
| InChIKey | NXFCBZMJBFLUPF-FZUBVGGKSA-N |
| XLogP | 4.86 |
| TPSA | 113.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.50 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|