C17H13N5O4S — CID 23850330
N-methyl-4-(4-nitrophenyl)-3-[(4-nitrophenyl)methylideneamino]-1,3-thiazol-2-imine (PubChem CID 23850330) has the molecular formula C17H13N5O4S and a molecular weight of 383.39 g/mol. Its IUPAC name is N-methyl-4-(4-nitrophenyl)-3-[(4-nitrophenyl)methylideneamino]-1,3-thiazol-2-imine.
| Compound Name | N-methyl-4-(4-nitrophenyl)-3-[(4-nitrophenyl)methylideneamino]-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 23850330 |
| Molecular Formula | C17H13N5O4S |
| Molecular Weight | 383.39 g/mol |
| Exact Mass | 383.07 |
| IUPAC Name | N-methyl-4-(4-nitrophenyl)-3-[(4-nitrophenyl)methylideneamino]-1,3-thiazol-2-imine |
| SMILES | C/N=c1\scc(-c2ccc([N+](=O)[O-])cc2)n1N=Cc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H13N5O4S/c1-18-17-20(19-10-12-2-6-14(7-3-12)21(23)24)16(11-27-17)13-4-8-15(9-5-13)22(25)26/h2-11H,1H3/b18-17-,19-10? |
| InChIKey | LYAHRQQABQUWPQ-OBPOFPIRSA-N |
| XLogP | 3.45 |
| TPSA | 115.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.39 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|